About N-[[2-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)phenyl]methyl]cyclopropanamine
N-[[2-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)phenyl]methyl]cyclopropanamine (PubChem CID 61032911) has the molecular formula C19H21NO
and a molecular weight of 279.38 g/mol. Its IUPAC name is N-[[2-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)phenyl]methyl]cyclopropanamine.
Molecular Properties
| Compound Name | N-[[2-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)phenyl]methyl]cyclopropanamine |
| PubChem CID | 61032911 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | N-[[2-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)phenyl]methyl]cyclopropanamine |
| SMILES | CC1Cc2cc(-c3ccccc3CNC3CC3)ccc2O1 |
| InChI | InChI=1S/C19H21NO/c1-13-10-16-11-14(6-9-19(16)21-13)18-5-3-2-4-15(18)12-20-17-7-8-17/h2-6,9,11,13,17,20H,7-8,10,12H2,1H3 |
| InChIKey | CJGQBYGMZSNXFT-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[[2-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)phenyl]methyl]cyclopropanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[2-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)phenyl]methyl]cyclopropanamine?
The IUPAC name of N-[[2-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)phenyl]methyl]cyclopropanamine (CID 61032911) is N-[[2-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)phenyl]methyl]cyclopropanamine.
What is the SMILES notation for N-[[2-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)phenyl]methyl]cyclopropanamine?
The canonical SMILES for N-[[2-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)phenyl]methyl]cyclopropanamine is CC1Cc2cc(-c3ccccc3CNC3CC3)ccc2O1.
What is the InChIKey of N-[[2-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)phenyl]methyl]cyclopropanamine?
The InChIKey is CJGQBYGMZSNXFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21NO/c1-13-10-16-11-14(6-9-19(16)21-13)18-5-3-2-4-15(18)12-20-17-7-8-17/h2-6,9,11,13,17,20H,7-8,10,12H2,1H3.
What are the key properties of N-[[2-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)phenyl]methyl]cyclopropanamine?
N-[[2-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)phenyl]methyl]cyclopropanamine has a molecular weight of 279.38 g/mol, XLogP of 3.93, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[2-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)phenyl]methyl]cyclopropanamine is sourced from PubChem (CID 61032911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).