C11H16FN — CID 61033992
N-[(2-fluoro-5-methylphenyl)methyl]propan-1-amine (PubChem CID 61033992) has the molecular formula C11H16FN and a molecular weight of 181.25 g/mol. Its IUPAC name is N-[(2-fluoro-5-methylphenyl)methyl]propan-1-amine.
| Compound Name | N-[(2-fluoro-5-methylphenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 61033992 |
| Molecular Formula | C11H16FN |
| Molecular Weight | 181.25 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | N-[(2-fluoro-5-methylphenyl)methyl]propan-1-amine |
| SMILES | CCCNCc1cc(C)ccc1F |
| InChI | InChI=1S/C11H16FN/c1-3-6-13-8-10-7-9(2)4-5-11(10)12/h4-5,7,13H,3,6,8H2,1-2H3 |
| InChIKey | TWWGLZGQCXNEHS-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.25 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|