C18H23NO2 — CID 61034037
N-[[3-(2,4-dimethoxyphenyl)phenyl]methyl]propan-1-amine (PubChem CID 61034037) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is N-[[3-(2,4-dimethoxyphenyl)phenyl]methyl]propan-1-amine.
| Compound Name | N-[[3-(2,4-dimethoxyphenyl)phenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 61034037 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | N-[[3-(2,4-dimethoxyphenyl)phenyl]methyl]propan-1-amine |
| SMILES | CCCNCc1cccc(-c2ccc(OC)cc2OC)c1 |
| InChI | InChI=1S/C18H23NO2/c1-4-10-19-13-14-6-5-7-15(11-14)17-9-8-16(20-2)12-18(17)21-3/h5-9,11-12,19H,4,10,13H2,1-3H3 |
| InChIKey | UBPYFSMYQGXNRB-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|