C14H11Br3N2O2 — CID 61035585
2-(3-aminophenoxy)-N-(2,4,6-tribromophenyl)acetamide (PubChem CID 61035585) has the molecular formula C14H11Br3N2O2 and a molecular weight of 478.97 g/mol. Its IUPAC name is 2-(3-aminophenoxy)-N-(2,4,6-tribromophenyl)acetamide.
| Compound Name | 2-(3-aminophenoxy)-N-(2,4,6-tribromophenyl)acetamide |
|---|---|
| PubChem CID | 61035585 |
| Molecular Formula | C14H11Br3N2O2 |
| Molecular Weight | 478.97 g/mol |
| Exact Mass | 475.84 |
| IUPAC Name | 2-(3-aminophenoxy)-N-(2,4,6-tribromophenyl)acetamide |
| SMILES | Nc1cccc(OCC(=O)Nc2c(Br)cc(Br)cc2Br)c1 |
| InChI | InChI=1S/C14H11Br3N2O2/c15-8-4-11(16)14(12(17)5-8)19-13(20)7-21-10-3-1-2-9(18)6-10/h1-6H,7,18H2,(H,19,20) |
| InChIKey | HPXVANAWFYUPQI-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.97 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|