About 3-[(3-nitroimidazo[1,2-a]pyridin-2-yl)methoxy]aniline
3-[(3-nitroimidazo[1,2-a]pyridin-2-yl)methoxy]aniline (PubChem CID 61036118) has the molecular formula C14H12N4O3
and a molecular weight of 284.28 g/mol. Its IUPAC name is 3-[(3-nitroimidazo[1,2-a]pyridin-2-yl)methoxy]aniline.
Molecular Properties
| Compound Name | 3-[(3-nitroimidazo[1,2-a]pyridin-2-yl)methoxy]aniline |
| PubChem CID | 61036118 |
| Molecular Formula | C14H12N4O3 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 3-[(3-nitroimidazo[1,2-a]pyridin-2-yl)methoxy]aniline |
| SMILES | Nc1cccc(OCc2nc3ccccn3c2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H12N4O3/c15-10-4-3-5-11(8-10)21-9-12-14(18(19)20)17-7-2-1-6-13(17)16-12/h1-8H,9,15H2 |
| InChIKey | UQTRKRCRWHAYDI-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3-nitroimidazo[1,2-a]pyridin-2-yl)methoxy]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-nitroimidazo[1,2-a]pyridin-2-yl)methoxy]aniline?
The IUPAC name of 3-[(3-nitroimidazo[1,2-a]pyridin-2-yl)methoxy]aniline (CID 61036118) is 3-[(3-nitroimidazo[1,2-a]pyridin-2-yl)methoxy]aniline.
What is the SMILES notation for 3-[(3-nitroimidazo[1,2-a]pyridin-2-yl)methoxy]aniline?
The canonical SMILES for 3-[(3-nitroimidazo[1,2-a]pyridin-2-yl)methoxy]aniline is Nc1cccc(OCc2nc3ccccn3c2[N+](=O)[O-])c1.
What is the InChIKey of 3-[(3-nitroimidazo[1,2-a]pyridin-2-yl)methoxy]aniline?
The InChIKey is UQTRKRCRWHAYDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N4O3/c15-10-4-3-5-11(8-10)21-9-12-14(18(19)20)17-7-2-1-6-13(17)16-12/h1-8H,9,15H2.
What are the key properties of 3-[(3-nitroimidazo[1,2-a]pyridin-2-yl)methoxy]aniline?
3-[(3-nitroimidazo[1,2-a]pyridin-2-yl)methoxy]aniline has a molecular weight of 284.28 g/mol, XLogP of 2.40, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-nitroimidazo[1,2-a]pyridin-2-yl)methoxy]aniline is sourced from PubChem (CID 61036118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).