About 9-methoxyphenanthrene
9-methoxyphenanthrene (PubChem CID 610364) has the molecular formula C15H12O
and a molecular weight of 208.26 g/mol. Its IUPAC name is 9-methoxyphenanthrene.
Molecular Properties
| Compound Name | 9-methoxyphenanthrene |
| PubChem CID | 610364 |
| Molecular Formula | C15H12O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 9-methoxyphenanthrene |
| SMILES | COc1cc2ccccc2c2ccccc12 |
| InChI | InChI=1S/C15H12O/c1-16-15-10-11-6-2-3-7-12(11)13-8-4-5-9-14(13)15/h2-10H,1H3 |
| InChIKey | BPGOLTXKNOSDMR-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 9-methoxyphenanthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methoxyphenanthrene?
The IUPAC name of 9-methoxyphenanthrene (CID 610364) is 9-methoxyphenanthrene.
What is the SMILES notation for 9-methoxyphenanthrene?
The canonical SMILES for 9-methoxyphenanthrene is COc1cc2ccccc2c2ccccc12.
What is the InChIKey of 9-methoxyphenanthrene?
The InChIKey is BPGOLTXKNOSDMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12O/c1-16-15-10-11-6-2-3-7-12(11)13-8-4-5-9-14(13)15/h2-10H,1H3.
What are the key properties of 9-methoxyphenanthrene?
9-methoxyphenanthrene has a molecular weight of 208.26 g/mol, XLogP of 4.00, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methoxyphenanthrene is sourced from PubChem (CID 610364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).