About N-ethyl-5-pyrazin-2-yl-1,3,4-thiadiazol-2-amine
N-ethyl-5-pyrazin-2-yl-1,3,4-thiadiazol-2-amine (PubChem CID 61037157) has the molecular formula C8H9N5S
and a molecular weight of 207.26 g/mol. Its IUPAC name is N-ethyl-5-pyrazin-2-yl-1,3,4-thiadiazol-2-amine.
Molecular Properties
| Compound Name | N-ethyl-5-pyrazin-2-yl-1,3,4-thiadiazol-2-amine |
| PubChem CID | 61037157 |
| Molecular Formula | C8H9N5S |
| Molecular Weight | 207.26 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | N-ethyl-5-pyrazin-2-yl-1,3,4-thiadiazol-2-amine |
| SMILES | CCNc1nnc(-c2cnccn2)s1 |
| InChI | InChI=1S/C8H9N5S/c1-2-10-8-13-12-7(14-8)6-5-9-3-4-11-6/h3-5H,2H2,1H3,(H,10,13) |
| InChIKey | FJJABYFDYUVLEE-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.26 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-ethyl-5-pyrazin-2-yl-1,3,4-thiadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-5-pyrazin-2-yl-1,3,4-thiadiazol-2-amine?
The IUPAC name of N-ethyl-5-pyrazin-2-yl-1,3,4-thiadiazol-2-amine (CID 61037157) is N-ethyl-5-pyrazin-2-yl-1,3,4-thiadiazol-2-amine.
What is the SMILES notation for N-ethyl-5-pyrazin-2-yl-1,3,4-thiadiazol-2-amine?
The canonical SMILES for N-ethyl-5-pyrazin-2-yl-1,3,4-thiadiazol-2-amine is CCNc1nnc(-c2cnccn2)s1.
What is the InChIKey of N-ethyl-5-pyrazin-2-yl-1,3,4-thiadiazol-2-amine?
The InChIKey is FJJABYFDYUVLEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N5S/c1-2-10-8-13-12-7(14-8)6-5-9-3-4-11-6/h3-5H,2H2,1H3,(H,10,13).
What are the key properties of N-ethyl-5-pyrazin-2-yl-1,3,4-thiadiazol-2-amine?
N-ethyl-5-pyrazin-2-yl-1,3,4-thiadiazol-2-amine has a molecular weight of 207.26 g/mol, XLogP of 1.43, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-5-pyrazin-2-yl-1,3,4-thiadiazol-2-amine is sourced from PubChem (CID 61037157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).