C14H20Cl2N2 — CID 61037688
N-[(3,5-dichlorophenyl)methyl]-2-piperidin-1-ylethanamine (PubChem CID 61037688) has the molecular formula C14H20Cl2N2 and a molecular weight of 287.23 g/mol. Its IUPAC name is N-[(3,5-dichlorophenyl)methyl]-2-piperidin-1-ylethanamine.
| Compound Name | N-[(3,5-dichlorophenyl)methyl]-2-piperidin-1-ylethanamine |
|---|---|
| PubChem CID | 61037688 |
| Molecular Formula | C14H20Cl2N2 |
| Molecular Weight | 287.23 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | N-[(3,5-dichlorophenyl)methyl]-2-piperidin-1-ylethanamine |
| SMILES | Clc1cc(Cl)cc(CNCCN2CCCCC2)c1 |
| InChI | InChI=1S/C14H20Cl2N2/c15-13-8-12(9-14(16)10-13)11-17-4-7-18-5-2-1-3-6-18/h8-10,17H,1-7,11H2 |
| InChIKey | VJHPMFIIBNHNAZ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.23 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|