C9H6ClN3O2S — CID 61038453
2-[(4-chloro-1,2,5-thiadiazol-3-yl)oxy]benzamide (PubChem CID 61038453) has the molecular formula C9H6ClN3O2S and a molecular weight of 255.69 g/mol. Its IUPAC name is 2-[(4-chloro-1,2,5-thiadiazol-3-yl)oxy]benzamide.
| Compound Name | 2-[(4-chloro-1,2,5-thiadiazol-3-yl)oxy]benzamide |
|---|---|
| PubChem CID | 61038453 |
| Molecular Formula | C9H6ClN3O2S |
| Molecular Weight | 255.69 g/mol |
| Exact Mass | 254.99 |
| IUPAC Name | 2-[(4-chloro-1,2,5-thiadiazol-3-yl)oxy]benzamide |
| SMILES | NC(=O)c1ccccc1Oc1nsnc1Cl |
| InChI | InChI=1S/C9H6ClN3O2S/c10-7-9(13-16-12-7)15-6-4-2-1-3-5(6)8(11)14/h1-4H,(H2,11,14) |
| InChIKey | LCAFAWWEBFFOQA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.69 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |