About 2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)-N-(3-hydroxypropyl)-N-propan-2-ylacetamide
2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)-N-(3-hydroxypropyl)-N-propan-2-ylacetamide (PubChem CID 61039456) has the molecular formula C14H23N3O3
and a molecular weight of 281.36 g/mol. Its IUPAC name is 2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)-N-(3-hydroxypropyl)-N-propan-2-ylacetamide.
Molecular Properties
| Compound Name | 2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)-N-(3-hydroxypropyl)-N-propan-2-ylacetamide |
| PubChem CID | 61039456 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)-N-(3-hydroxypropyl)-N-propan-2-ylacetamide |
| SMILES | Cc1nc(=O)[nH]c(C)c1CC(=O)N(CCCO)C(C)C |
| InChI | InChI=1S/C14H23N3O3/c1-9(2)17(6-5-7-18)13(19)8-12-10(3)15-14(20)16-11(12)4/h9,18H,5-8H2,1-4H3,(H,15,16,20) |
| InChIKey | JZENPONXWPRDFF-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)-N-(3-hydroxypropyl)-N-propan-2-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)-N-(3-hydroxypropyl)-N-propan-2-ylacetamide?
The IUPAC name of 2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)-N-(3-hydroxypropyl)-N-propan-2-ylacetamide (CID 61039456) is 2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)-N-(3-hydroxypropyl)-N-propan-2-ylacetamide.
What is the SMILES notation for 2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)-N-(3-hydroxypropyl)-N-propan-2-ylacetamide?
The canonical SMILES for 2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)-N-(3-hydroxypropyl)-N-propan-2-ylacetamide is Cc1nc(=O)[nH]c(C)c1CC(=O)N(CCCO)C(C)C.
What is the InChIKey of 2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)-N-(3-hydroxypropyl)-N-propan-2-ylacetamide?
The InChIKey is JZENPONXWPRDFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3O3/c1-9(2)17(6-5-7-18)13(19)8-12-10(3)15-14(20)16-11(12)4/h9,18H,5-8H2,1-4H3,(H,15,16,20).
What are the key properties of 2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)-N-(3-hydroxypropyl)-N-propan-2-ylacetamide?
2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)-N-(3-hydroxypropyl)-N-propan-2-ylacetamide has a molecular weight of 281.36 g/mol, XLogP of 0.55, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)-N-(3-hydroxypropyl)-N-propan-2-ylacetamide is sourced from PubChem (CID 61039456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).