C14H26N2O4 — CID 61039677
N-(3-hydroxypropyl)-1-(2-methoxyethyl)-5-oxo-N-propan-2-ylpyrrolidine-3-carboxamide (PubChem CID 61039677) has the molecular formula C14H26N2O4 and a molecular weight of 286.37 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-1-(2-methoxyethyl)-5-oxo-N-propan-2-ylpyrrolidine-3-carboxamide.
| Compound Name | N-(3-hydroxypropyl)-1-(2-methoxyethyl)-5-oxo-N-propan-2-ylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 61039677 |
| Molecular Formula | C14H26N2O4 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | N-(3-hydroxypropyl)-1-(2-methoxyethyl)-5-oxo-N-propan-2-ylpyrrolidine-3-carboxamide |
| SMILES | COCCN1CC(C(=O)N(CCCO)C(C)C)CC1=O |
| InChI | InChI=1S/C14H26N2O4/c1-11(2)16(5-4-7-17)14(19)12-9-13(18)15(10-12)6-8-20-3/h11-12,17H,4-10H2,1-3H3 |
| InChIKey | ULCFBZIDACXDCZ-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |