C15H22ClNO3 — CID 61039684
2-(4-chloro-3-methylphenoxy)-N-(3-hydroxypropyl)-N-propan-2-ylacetamide (PubChem CID 61039684) has the molecular formula C15H22ClNO3 and a molecular weight of 299.80 g/mol. Its IUPAC name is 2-(4-chloro-3-methylphenoxy)-N-(3-hydroxypropyl)-N-propan-2-ylacetamide.
| Compound Name | 2-(4-chloro-3-methylphenoxy)-N-(3-hydroxypropyl)-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 61039684 |
| Molecular Formula | C15H22ClNO3 |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 2-(4-chloro-3-methylphenoxy)-N-(3-hydroxypropyl)-N-propan-2-ylacetamide |
| SMILES | Cc1cc(OCC(=O)N(CCCO)C(C)C)ccc1Cl |
| InChI | InChI=1S/C15H22ClNO3/c1-11(2)17(7-4-8-18)15(19)10-20-13-5-6-14(16)12(3)9-13/h5-6,9,11,18H,4,7-8,10H2,1-3H3 |
| InChIKey | BCBTUOOYYUADTF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |