C15H14ClN3O — CID 61041207
6-chloro-N-[cyclopropyl(phenyl)methyl]pyridazine-3-carboxamide (PubChem CID 61041207) has the molecular formula C15H14ClN3O and a molecular weight of 287.75 g/mol. Its IUPAC name is 6-chloro-N-[cyclopropyl(phenyl)methyl]pyridazine-3-carboxamide.
| Compound Name | 6-chloro-N-[cyclopropyl(phenyl)methyl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 61041207 |
| Molecular Formula | C15H14ClN3O |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 6-chloro-N-[cyclopropyl(phenyl)methyl]pyridazine-3-carboxamide |
| SMILES | O=C(NC(c1ccccc1)C1CC1)c1ccc(Cl)nn1 |
| InChI | InChI=1S/C15H14ClN3O/c16-13-9-8-12(18-19-13)15(20)17-14(11-6-7-11)10-4-2-1-3-5-10/h1-5,8-9,11,14H,6-7H2,(H,17,20) |
| InChIKey | HKHXTXBFXYBLFX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |