C12H21N3O5S — CID 61041905
2-(4-sulfamoylpiperazine-1-carbonyl)cyclohexane-1-carboxylic acid (PubChem CID 61041905) has the molecular formula C12H21N3O5S and a molecular weight of 319.38 g/mol. Its IUPAC name is 2-(4-sulfamoylpiperazine-1-carbonyl)cyclohexane-1-carboxylic acid.
| Compound Name | 2-(4-sulfamoylpiperazine-1-carbonyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 61041905 |
| Molecular Formula | C12H21N3O5S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 2-(4-sulfamoylpiperazine-1-carbonyl)cyclohexane-1-carboxylic acid |
| SMILES | NS(=O)(=O)N1CCN(C(=O)C2CCCCC2C(=O)O)CC1 |
| InChI | InChI=1S/C12H21N3O5S/c13-21(19,20)15-7-5-14(6-8-15)11(16)9-3-1-2-4-10(9)12(17)18/h9-10H,1-8H2,(H,17,18)(H2,13,19,20) |
| InChIKey | NZAMWDWRCUYMCB-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 121.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |