C11H10FN3O2S — CID 61043004
3-fluoro-N-[(4-methyl-1,3-thiazol-2-yl)methyl]-2-nitroaniline (PubChem CID 61043004) has the molecular formula C11H10FN3O2S and a molecular weight of 267.29 g/mol. Its IUPAC name is 3-fluoro-N-[(4-methyl-1,3-thiazol-2-yl)methyl]-2-nitroaniline.
| Compound Name | 3-fluoro-N-[(4-methyl-1,3-thiazol-2-yl)methyl]-2-nitroaniline |
|---|---|
| PubChem CID | 61043004 |
| Molecular Formula | C11H10FN3O2S |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 3-fluoro-N-[(4-methyl-1,3-thiazol-2-yl)methyl]-2-nitroaniline |
| SMILES | Cc1csc(CNc2cccc(F)c2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C11H10FN3O2S/c1-7-6-18-10(14-7)5-13-9-4-2-3-8(12)11(9)15(16)17/h2-4,6,13H,5H2,1H3 |
| InChIKey | NDZCQFSMWOENAB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|