About 5-bromoquinoxaline
5-bromoquinoxaline (PubChem CID 610437) has the molecular formula C8H5BrN2
and a molecular weight of 209.05 g/mol. Its IUPAC name is 5-bromoquinoxaline.
Molecular Properties
| Compound Name | 5-bromoquinoxaline |
| PubChem CID | 610437 |
| Molecular Formula | C8H5BrN2 |
| Molecular Weight | 209.05 g/mol |
| Exact Mass | 207.96 |
| IUPAC Name | 5-bromoquinoxaline |
| SMILES | Brc1cccc2nccnc12 |
| InChI | InChI=1S/C8H5BrN2/c9-6-2-1-3-7-8(6)11-5-4-10-7/h1-5H |
| InChIKey | UJEGBESUCWOWNQ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.05 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromoquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromoquinoxaline?
The IUPAC name of 5-bromoquinoxaline (CID 610437) is 5-bromoquinoxaline.
What is the SMILES notation for 5-bromoquinoxaline?
The canonical SMILES for 5-bromoquinoxaline is Brc1cccc2nccnc12.
What is the InChIKey of 5-bromoquinoxaline?
The InChIKey is UJEGBESUCWOWNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5BrN2/c9-6-2-1-3-7-8(6)11-5-4-10-7/h1-5H.
What are the key properties of 5-bromoquinoxaline?
5-bromoquinoxaline has a molecular weight of 209.05 g/mol, XLogP of 2.39, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromoquinoxaline is sourced from PubChem (CID 610437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).