About 5-[1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]pyrrolidin-2-yl]-3-methyl-1,2-oxazole
5-[1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]pyrrolidin-2-yl]-3-methyl-1,2-oxazole (PubChem CID 61044817) has the molecular formula C11H12ClN3O3S2
and a molecular weight of 333.82 g/mol. Its IUPAC name is 5-[1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]pyrrolidin-2-yl]-3-methyl-1,2-oxazole.
Molecular Properties
| Compound Name | 5-[1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]pyrrolidin-2-yl]-3-methyl-1,2-oxazole |
| PubChem CID | 61044817 |
| Molecular Formula | C11H12ClN3O3S2 |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | 5-[1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]pyrrolidin-2-yl]-3-methyl-1,2-oxazole |
| SMILES | Cc1cc(C2CCCN2S(=O)(=O)c2cnc(Cl)s2)on1 |
| InChI | InChI=1S/C11H12ClN3O3S2/c1-7-5-9(18-14-7)8-3-2-4-15(8)20(16,17)10-6-13-11(12)19-10/h5-6,8H,2-4H2,1H3 |
| InChIKey | ZCKXIDIANAYWRN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]pyrrolidin-2-yl]-3-methyl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]pyrrolidin-2-yl]-3-methyl-1,2-oxazole?
The IUPAC name of 5-[1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]pyrrolidin-2-yl]-3-methyl-1,2-oxazole (CID 61044817) is 5-[1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]pyrrolidin-2-yl]-3-methyl-1,2-oxazole.
What is the SMILES notation for 5-[1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]pyrrolidin-2-yl]-3-methyl-1,2-oxazole?
The canonical SMILES for 5-[1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]pyrrolidin-2-yl]-3-methyl-1,2-oxazole is Cc1cc(C2CCCN2S(=O)(=O)c2cnc(Cl)s2)on1.
What is the InChIKey of 5-[1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]pyrrolidin-2-yl]-3-methyl-1,2-oxazole?
The InChIKey is ZCKXIDIANAYWRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClN3O3S2/c1-7-5-9(18-14-7)8-3-2-4-15(8)20(16,17)10-6-13-11(12)19-10/h5-6,8H,2-4H2,1H3.
What are the key properties of 5-[1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]pyrrolidin-2-yl]-3-methyl-1,2-oxazole?
5-[1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]pyrrolidin-2-yl]-3-methyl-1,2-oxazole has a molecular weight of 333.82 g/mol, XLogP of 2.62, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]pyrrolidin-2-yl]-3-methyl-1,2-oxazole is sourced from PubChem (CID 61044817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).