About N-[1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperidin-4-yl]-2-methylpropanamide
N-[1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperidin-4-yl]-2-methylpropanamide (PubChem CID 61045226) has the molecular formula C12H18ClN3O3S2
and a molecular weight of 351.88 g/mol. Its IUPAC name is N-[1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperidin-4-yl]-2-methylpropanamide.
Molecular Properties
| Compound Name | N-[1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperidin-4-yl]-2-methylpropanamide |
| PubChem CID | 61045226 |
| Molecular Formula | C12H18ClN3O3S2 |
| Molecular Weight | 351.88 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | N-[1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperidin-4-yl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)NC1CCN(S(=O)(=O)c2cnc(Cl)s2)CC1 |
| InChI | InChI=1S/C12H18ClN3O3S2/c1-8(2)11(17)15-9-3-5-16(6-4-9)21(18,19)10-7-14-12(13)20-10/h7-9H,3-6H2,1-2H3,(H,15,17) |
| InChIKey | NAFBVFYXYJOUCL-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.88 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperidin-4-yl]-2-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperidin-4-yl]-2-methylpropanamide?
The IUPAC name of N-[1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperidin-4-yl]-2-methylpropanamide (CID 61045226) is N-[1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperidin-4-yl]-2-methylpropanamide.
What is the SMILES notation for N-[1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperidin-4-yl]-2-methylpropanamide?
The canonical SMILES for N-[1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperidin-4-yl]-2-methylpropanamide is CC(C)C(=O)NC1CCN(S(=O)(=O)c2cnc(Cl)s2)CC1.
What is the InChIKey of N-[1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperidin-4-yl]-2-methylpropanamide?
The InChIKey is NAFBVFYXYJOUCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18ClN3O3S2/c1-8(2)11(17)15-9-3-5-16(6-4-9)21(18,19)10-7-14-12(13)20-10/h7-9H,3-6H2,1-2H3,(H,15,17).
What are the key properties of N-[1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperidin-4-yl]-2-methylpropanamide?
N-[1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperidin-4-yl]-2-methylpropanamide has a molecular weight of 351.88 g/mol, XLogP of 1.72, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperidin-4-yl]-2-methylpropanamide is sourced from PubChem (CID 61045226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).