C12H17ClN2O3S2 — CID 61045232
4-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonyl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine (PubChem CID 61045232) has the molecular formula C12H17ClN2O3S2 and a molecular weight of 336.87 g/mol. Its IUPAC name is 4-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonyl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine.
| Compound Name | 4-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonyl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine |
|---|---|
| PubChem CID | 61045232 |
| Molecular Formula | C12H17ClN2O3S2 |
| Molecular Weight | 336.87 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 4-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonyl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine |
| SMILES | Cc1nc(Cl)sc1S(=O)(=O)N1CCOC2CCCCC21 |
| InChI | InChI=1S/C12H17ClN2O3S2/c1-8-11(19-12(13)14-8)20(16,17)15-6-7-18-10-5-3-2-4-9(10)15/h9-10H,2-7H2,1H3 |
| InChIKey | UIZZFHCBDDIQPA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.87 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |