C16H23F2NO2 — CID 61045823
2-(cyclohexylamino)-2-[2-(difluoromethoxy)phenyl]propan-1-ol (PubChem CID 61045823) has the molecular formula C16H23F2NO2 and a molecular weight of 299.36 g/mol. Its IUPAC name is 2-(cyclohexylamino)-2-[2-(difluoromethoxy)phenyl]propan-1-ol.
| Compound Name | 2-(cyclohexylamino)-2-[2-(difluoromethoxy)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 61045823 |
| Molecular Formula | C16H23F2NO2 |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 2-(cyclohexylamino)-2-[2-(difluoromethoxy)phenyl]propan-1-ol |
| SMILES | CC(CO)(NC1CCCCC1)c1ccccc1OC(F)F |
| InChI | InChI=1S/C16H23F2NO2/c1-16(11-20,19-12-7-3-2-4-8-12)13-9-5-6-10-14(13)21-15(17)18/h5-6,9-10,12,15,19-20H,2-4,7-8,11H2,1H3 |
| InChIKey | XBJJKTWJTHCWSV-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |