C10H12ClN3O2S — CID 61046475
2-chloro-N-(2-cyanoethyl)-N-ethylpyridine-3-sulfonamide (PubChem CID 61046475) has the molecular formula C10H12ClN3O2S and a molecular weight of 273.75 g/mol. Its IUPAC name is 2-chloro-N-(2-cyanoethyl)-N-ethylpyridine-3-sulfonamide.
| Compound Name | 2-chloro-N-(2-cyanoethyl)-N-ethylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 61046475 |
| Molecular Formula | C10H12ClN3O2S |
| Molecular Weight | 273.75 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | 2-chloro-N-(2-cyanoethyl)-N-ethylpyridine-3-sulfonamide |
| SMILES | CCN(CCC#N)S(=O)(=O)c1cccnc1Cl |
| InChI | InChI=1S/C10H12ClN3O2S/c1-2-14(8-4-6-12)17(15,16)9-5-3-7-13-10(9)11/h3,5,7H,2,4,8H2,1H3 |
| InChIKey | RIFQDLQFWMLCAF-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 74.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.75 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|