About ethyl 2-[(2-chloro-1,3-thiazol-5-yl)sulfonyl-(2-methoxyethyl)amino]acetate
ethyl 2-[(2-chloro-1,3-thiazol-5-yl)sulfonyl-(2-methoxyethyl)amino]acetate (PubChem CID 61046504) has the molecular formula C10H15ClN2O5S2
and a molecular weight of 342.83 g/mol. Its IUPAC name is ethyl 2-[(2-chloro-1,3-thiazol-5-yl)sulfonyl-(2-methoxyethyl)amino]acetate.
Molecular Properties
| Compound Name | ethyl 2-[(2-chloro-1,3-thiazol-5-yl)sulfonyl-(2-methoxyethyl)amino]acetate |
| PubChem CID | 61046504 |
| Molecular Formula | C10H15ClN2O5S2 |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | ethyl 2-[(2-chloro-1,3-thiazol-5-yl)sulfonyl-(2-methoxyethyl)amino]acetate |
| SMILES | CCOC(=O)CN(CCOC)S(=O)(=O)c1cnc(Cl)s1 |
| InChI | InChI=1S/C10H15ClN2O5S2/c1-3-18-8(14)7-13(4-5-17-2)20(15,16)9-6-12-10(11)19-9/h6H,3-5,7H2,1-2H3 |
| InChIKey | VNRUTRILESMIOR-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 2-[(2-chloro-1,3-thiazol-5-yl)sulfonyl-(2-methoxyethyl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(2-chloro-1,3-thiazol-5-yl)sulfonyl-(2-methoxyethyl)amino]acetate?
The IUPAC name of ethyl 2-[(2-chloro-1,3-thiazol-5-yl)sulfonyl-(2-methoxyethyl)amino]acetate (CID 61046504) is ethyl 2-[(2-chloro-1,3-thiazol-5-yl)sulfonyl-(2-methoxyethyl)amino]acetate.
What is the SMILES notation for ethyl 2-[(2-chloro-1,3-thiazol-5-yl)sulfonyl-(2-methoxyethyl)amino]acetate?
The canonical SMILES for ethyl 2-[(2-chloro-1,3-thiazol-5-yl)sulfonyl-(2-methoxyethyl)amino]acetate is CCOC(=O)CN(CCOC)S(=O)(=O)c1cnc(Cl)s1.
What is the InChIKey of ethyl 2-[(2-chloro-1,3-thiazol-5-yl)sulfonyl-(2-methoxyethyl)amino]acetate?
The InChIKey is VNRUTRILESMIOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15ClN2O5S2/c1-3-18-8(14)7-13(4-5-17-2)20(15,16)9-6-12-10(11)19-9/h6H,3-5,7H2,1-2H3.
What are the key properties of ethyl 2-[(2-chloro-1,3-thiazol-5-yl)sulfonyl-(2-methoxyethyl)amino]acetate?
ethyl 2-[(2-chloro-1,3-thiazol-5-yl)sulfonyl-(2-methoxyethyl)amino]acetate has a molecular weight of 342.83 g/mol, XLogP of 1.00, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(2-chloro-1,3-thiazol-5-yl)sulfonyl-(2-methoxyethyl)amino]acetate is sourced from PubChem (CID 61046504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).