About [1-methyl-4-(2,2,2-trifluoroethylamino)piperidin-4-yl]methanol
[1-methyl-4-(2,2,2-trifluoroethylamino)piperidin-4-yl]methanol (PubChem CID 61047127) has the molecular formula C9H17F3N2O
and a molecular weight of 226.24 g/mol. Its IUPAC name is [1-methyl-4-(2,2,2-trifluoroethylamino)piperidin-4-yl]methanol.
Molecular Properties
| Compound Name | [1-methyl-4-(2,2,2-trifluoroethylamino)piperidin-4-yl]methanol |
| PubChem CID | 61047127 |
| Molecular Formula | C9H17F3N2O |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | [1-methyl-4-(2,2,2-trifluoroethylamino)piperidin-4-yl]methanol |
| SMILES | CN1CCC(CO)(NCC(F)(F)F)CC1 |
| InChI | InChI=1S/C9H17F3N2O/c1-14-4-2-8(7-15,3-5-14)13-6-9(10,11)12/h13,15H,2-7H2,1H3 |
| InChIKey | WJYMIJGWLRSITH-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-methyl-4-(2,2,2-trifluoroethylamino)piperidin-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-methyl-4-(2,2,2-trifluoroethylamino)piperidin-4-yl]methanol?
The IUPAC name of [1-methyl-4-(2,2,2-trifluoroethylamino)piperidin-4-yl]methanol (CID 61047127) is [1-methyl-4-(2,2,2-trifluoroethylamino)piperidin-4-yl]methanol.
What is the SMILES notation for [1-methyl-4-(2,2,2-trifluoroethylamino)piperidin-4-yl]methanol?
The canonical SMILES for [1-methyl-4-(2,2,2-trifluoroethylamino)piperidin-4-yl]methanol is CN1CCC(CO)(NCC(F)(F)F)CC1.
What is the InChIKey of [1-methyl-4-(2,2,2-trifluoroethylamino)piperidin-4-yl]methanol?
The InChIKey is WJYMIJGWLRSITH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F3N2O/c1-14-4-2-8(7-15,3-5-14)13-6-9(10,11)12/h13,15H,2-7H2,1H3.
What are the key properties of [1-methyl-4-(2,2,2-trifluoroethylamino)piperidin-4-yl]methanol?
[1-methyl-4-(2,2,2-trifluoroethylamino)piperidin-4-yl]methanol has a molecular weight of 226.24 g/mol, XLogP of 0.60, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-methyl-4-(2,2,2-trifluoroethylamino)piperidin-4-yl]methanol is sourced from PubChem (CID 61047127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).