About 2-fluoro-N,N-bis(2-hydroxyethyl)-5-methylsulfonylbenzenesulfonamide
2-fluoro-N,N-bis(2-hydroxyethyl)-5-methylsulfonylbenzenesulfonamide (PubChem CID 61047219) has the molecular formula C11H16FNO6S2
and a molecular weight of 341.38 g/mol. Its IUPAC name is 2-fluoro-N,N-bis(2-hydroxyethyl)-5-methylsulfonylbenzenesulfonamide.
Molecular Properties
| Compound Name | 2-fluoro-N,N-bis(2-hydroxyethyl)-5-methylsulfonylbenzenesulfonamide |
| PubChem CID | 61047219 |
| Molecular Formula | C11H16FNO6S2 |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 2-fluoro-N,N-bis(2-hydroxyethyl)-5-methylsulfonylbenzenesulfonamide |
| SMILES | CS(=O)(=O)c1ccc(F)c(S(=O)(=O)N(CCO)CCO)c1 |
| InChI | InChI=1S/C11H16FNO6S2/c1-20(16,17)9-2-3-10(12)11(8-9)21(18,19)13(4-6-14)5-7-15/h2-3,8,14-15H,4-7H2,1H3 |
| InChIKey | ZNZVBSBJPBGQGO-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-fluoro-N,N-bis(2-hydroxyethyl)-5-methylsulfonylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-N,N-bis(2-hydroxyethyl)-5-methylsulfonylbenzenesulfonamide?
The IUPAC name of 2-fluoro-N,N-bis(2-hydroxyethyl)-5-methylsulfonylbenzenesulfonamide (CID 61047219) is 2-fluoro-N,N-bis(2-hydroxyethyl)-5-methylsulfonylbenzenesulfonamide.
What is the SMILES notation for 2-fluoro-N,N-bis(2-hydroxyethyl)-5-methylsulfonylbenzenesulfonamide?
The canonical SMILES for 2-fluoro-N,N-bis(2-hydroxyethyl)-5-methylsulfonylbenzenesulfonamide is CS(=O)(=O)c1ccc(F)c(S(=O)(=O)N(CCO)CCO)c1.
What is the InChIKey of 2-fluoro-N,N-bis(2-hydroxyethyl)-5-methylsulfonylbenzenesulfonamide?
The InChIKey is ZNZVBSBJPBGQGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16FNO6S2/c1-20(16,17)9-2-3-10(12)11(8-9)21(18,19)13(4-6-14)5-7-15/h2-3,8,14-15H,4-7H2,1H3.
What are the key properties of 2-fluoro-N,N-bis(2-hydroxyethyl)-5-methylsulfonylbenzenesulfonamide?
2-fluoro-N,N-bis(2-hydroxyethyl)-5-methylsulfonylbenzenesulfonamide has a molecular weight of 341.38 g/mol, XLogP of -0.80, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-N,N-bis(2-hydroxyethyl)-5-methylsulfonylbenzenesulfonamide is sourced from PubChem (CID 61047219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).