About 1-[(Z)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]tetrazol-5-amine
1-[(Z)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]tetrazol-5-amine (PubChem CID 6104723) has the molecular formula C9H8Br2N6O
and a molecular weight of 376.01 g/mol. Its IUPAC name is 1-[(Z)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]tetrazol-5-amine.
Molecular Properties
| Compound Name | 1-[(Z)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]tetrazol-5-amine |
| PubChem CID | 6104723 |
| Molecular Formula | C9H8Br2N6O |
| Molecular Weight | 376.01 g/mol |
| Exact Mass | 373.91 |
| IUPAC Name | 1-[(Z)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]tetrazol-5-amine |
| SMILES | COc1c(Br)cc(Br)cc1/C=N\n1nnnc1N |
| InChI | InChI=1S/C9H8Br2N6O/c1-18-8-5(2-6(10)3-7(8)11)4-13-17-9(12)14-15-16-17/h2-4H,1H3,(H2,12,14,16)/b13-4- |
| InChIKey | WBPXXNRNHTVCKA-PQMHYQBVSA-N |
| XLogP | 1.67 |
| TPSA | 91.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.01 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[(Z)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]tetrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(Z)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]tetrazol-5-amine?
The IUPAC name of 1-[(Z)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]tetrazol-5-amine (CID 6104723) is 1-[(Z)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]tetrazol-5-amine.
What is the SMILES notation for 1-[(Z)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]tetrazol-5-amine?
The canonical SMILES for 1-[(Z)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]tetrazol-5-amine is COc1c(Br)cc(Br)cc1/C=N\n1nnnc1N.
What is the InChIKey of 1-[(Z)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]tetrazol-5-amine?
The InChIKey is WBPXXNRNHTVCKA-PQMHYQBVSA-N. The full InChI is InChI=1S/C9H8Br2N6O/c1-18-8-5(2-6(10)3-7(8)11)4-13-17-9(12)14-15-16-17/h2-4H,1H3,(H2,12,14,16)/b13-4-.
What are the key properties of 1-[(Z)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]tetrazol-5-amine?
1-[(Z)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]tetrazol-5-amine has a molecular weight of 376.01 g/mol, XLogP of 1.67, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(Z)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]tetrazol-5-amine is sourced from PubChem (CID 6104723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).