About N-[1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperidin-3-yl]acetamide
N-[1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperidin-3-yl]acetamide (PubChem CID 61047620) has the molecular formula C10H14ClN3O3S2
and a molecular weight of 323.83 g/mol. Its IUPAC name is N-[1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperidin-3-yl]acetamide.
Molecular Properties
| Compound Name | N-[1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperidin-3-yl]acetamide |
| PubChem CID | 61047620 |
| Molecular Formula | C10H14ClN3O3S2 |
| Molecular Weight | 323.83 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | N-[1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperidin-3-yl]acetamide |
| SMILES | CC(=O)NC1CCCN(S(=O)(=O)c2cnc(Cl)s2)C1 |
| InChI | InChI=1S/C10H14ClN3O3S2/c1-7(15)13-8-3-2-4-14(6-8)19(16,17)9-5-12-10(11)18-9/h5,8H,2-4,6H2,1H3,(H,13,15) |
| InChIKey | DPWCVIRLVFQSJF-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.83 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperidin-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperidin-3-yl]acetamide?
The IUPAC name of N-[1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperidin-3-yl]acetamide (CID 61047620) is N-[1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperidin-3-yl]acetamide.
What is the SMILES notation for N-[1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperidin-3-yl]acetamide?
The canonical SMILES for N-[1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperidin-3-yl]acetamide is CC(=O)NC1CCCN(S(=O)(=O)c2cnc(Cl)s2)C1.
What is the InChIKey of N-[1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperidin-3-yl]acetamide?
The InChIKey is DPWCVIRLVFQSJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14ClN3O3S2/c1-7(15)13-8-3-2-4-14(6-8)19(16,17)9-5-12-10(11)18-9/h5,8H,2-4,6H2,1H3,(H,13,15).
What are the key properties of N-[1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperidin-3-yl]acetamide?
N-[1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperidin-3-yl]acetamide has a molecular weight of 323.83 g/mol, XLogP of 1.09, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperidin-3-yl]acetamide is sourced from PubChem (CID 61047620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).