About [1-(4-bromoanilino)-3,4-dihydro-2H-naphthalen-1-yl]methanol
[1-(4-bromoanilino)-3,4-dihydro-2H-naphthalen-1-yl]methanol (PubChem CID 61048656) has the molecular formula C17H18BrNO
and a molecular weight of 332.24 g/mol. Its IUPAC name is [1-(4-bromoanilino)-3,4-dihydro-2H-naphthalen-1-yl]methanol.
Molecular Properties
| Compound Name | [1-(4-bromoanilino)-3,4-dihydro-2H-naphthalen-1-yl]methanol |
| PubChem CID | 61048656 |
| Molecular Formula | C17H18BrNO |
| Molecular Weight | 332.24 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | [1-(4-bromoanilino)-3,4-dihydro-2H-naphthalen-1-yl]methanol |
| SMILES | OCC1(Nc2ccc(Br)cc2)CCCc2ccccc21 |
| InChI | InChI=1S/C17H18BrNO/c18-14-7-9-15(10-8-14)19-17(12-20)11-3-5-13-4-1-2-6-16(13)17/h1-2,4,6-10,19-20H,3,5,11-12H2 |
| InChIKey | RFCYXYTYFUKYII-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.24 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [1-(4-bromoanilino)-3,4-dihydro-2H-naphthalen-1-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4-bromoanilino)-3,4-dihydro-2H-naphthalen-1-yl]methanol?
The IUPAC name of [1-(4-bromoanilino)-3,4-dihydro-2H-naphthalen-1-yl]methanol (CID 61048656) is [1-(4-bromoanilino)-3,4-dihydro-2H-naphthalen-1-yl]methanol.
What is the SMILES notation for [1-(4-bromoanilino)-3,4-dihydro-2H-naphthalen-1-yl]methanol?
The canonical SMILES for [1-(4-bromoanilino)-3,4-dihydro-2H-naphthalen-1-yl]methanol is OCC1(Nc2ccc(Br)cc2)CCCc2ccccc21.
What is the InChIKey of [1-(4-bromoanilino)-3,4-dihydro-2H-naphthalen-1-yl]methanol?
The InChIKey is RFCYXYTYFUKYII-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18BrNO/c18-14-7-9-15(10-8-14)19-17(12-20)11-3-5-13-4-1-2-6-16(13)17/h1-2,4,6-10,19-20H,3,5,11-12H2.
What are the key properties of [1-(4-bromoanilino)-3,4-dihydro-2H-naphthalen-1-yl]methanol?
[1-(4-bromoanilino)-3,4-dihydro-2H-naphthalen-1-yl]methanol has a molecular weight of 332.24 g/mol, XLogP of 4.09, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4-bromoanilino)-3,4-dihydro-2H-naphthalen-1-yl]methanol is sourced from PubChem (CID 61048656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).