C12H21NO3 — CID 6104993
(E)-4-oxo-4-(2,4,4-trimethylpentan-2-ylamino)but-2-enoic acid (PubChem CID 6104993) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is (E)-4-oxo-4-(2,4,4-trimethylpentan-2-ylamino)but-2-enoic acid.
| Compound Name | (E)-4-oxo-4-(2,4,4-trimethylpentan-2-ylamino)but-2-enoic acid |
|---|---|
| PubChem CID | 6104993 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | (E)-4-oxo-4-(2,4,4-trimethylpentan-2-ylamino)but-2-enoic acid |
| SMILES | CC(C)(C)CC(C)(C)NC(=O)/C=C/C(=O)O |
| InChI | InChI=1S/C12H21NO3/c1-11(2,3)8-12(4,5)13-9(14)6-7-10(15)16/h6-7H,8H2,1-5H3,(H,13,14)(H,15,16)/b7-6+ |
| InChIKey | LDWOVVMBOIZDML-VOTSOKGWSA-N |
| XLogP | 1.96 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|