About N-[(Z)-1-(1,3-dioxoinden-2-yl)ethylideneamino]benzamide
N-[(Z)-1-(1,3-dioxoinden-2-yl)ethylideneamino]benzamide (PubChem CID 6105059) has the molecular formula C18H14N2O3
and a molecular weight of 306.32 g/mol. Its IUPAC name is N-[(Z)-1-(1,3-dioxoinden-2-yl)ethylideneamino]benzamide.
Molecular Properties
| Compound Name | N-[(Z)-1-(1,3-dioxoinden-2-yl)ethylideneamino]benzamide |
| PubChem CID | 6105059 |
| Molecular Formula | C18H14N2O3 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | N-[(Z)-1-(1,3-dioxoinden-2-yl)ethylideneamino]benzamide |
| SMILES | C/C(=N/NC(=O)c1ccccc1)C1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H14N2O3/c1-11(19-20-18(23)12-7-3-2-4-8-12)15-16(21)13-9-5-6-10-14(13)17(15)22/h2-10,15H,1H3,(H,20,23)/b19-11- |
| InChIKey | BVUDRKASGXNRHW-ODLFYWEKSA-N |
| XLogP | 2.49 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-1-(1,3-dioxoinden-2-yl)ethylideneamino]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-1-(1,3-dioxoinden-2-yl)ethylideneamino]benzamide?
The IUPAC name of N-[(Z)-1-(1,3-dioxoinden-2-yl)ethylideneamino]benzamide (CID 6105059) is N-[(Z)-1-(1,3-dioxoinden-2-yl)ethylideneamino]benzamide.
What is the SMILES notation for N-[(Z)-1-(1,3-dioxoinden-2-yl)ethylideneamino]benzamide?
The canonical SMILES for N-[(Z)-1-(1,3-dioxoinden-2-yl)ethylideneamino]benzamide is C/C(=N/NC(=O)c1ccccc1)C1C(=O)c2ccccc2C1=O.
What is the InChIKey of N-[(Z)-1-(1,3-dioxoinden-2-yl)ethylideneamino]benzamide?
The InChIKey is BVUDRKASGXNRHW-ODLFYWEKSA-N. The full InChI is InChI=1S/C18H14N2O3/c1-11(19-20-18(23)12-7-3-2-4-8-12)15-16(21)13-9-5-6-10-14(13)17(15)22/h2-10,15H,1H3,(H,20,23)/b19-11-.
What are the key properties of N-[(Z)-1-(1,3-dioxoinden-2-yl)ethylideneamino]benzamide?
N-[(Z)-1-(1,3-dioxoinden-2-yl)ethylideneamino]benzamide has a molecular weight of 306.32 g/mol, XLogP of 2.49, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-1-(1,3-dioxoinden-2-yl)ethylideneamino]benzamide is sourced from PubChem (CID 6105059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).