C14H16FN3O3 — CID 61050993
N-(2-cyanoethyl)-5-fluoro-N-(2-methylpropyl)-2-nitrobenzamide (PubChem CID 61050993) has the molecular formula C14H16FN3O3 and a molecular weight of 293.30 g/mol. Its IUPAC name is N-(2-cyanoethyl)-5-fluoro-N-(2-methylpropyl)-2-nitrobenzamide.
| Compound Name | N-(2-cyanoethyl)-5-fluoro-N-(2-methylpropyl)-2-nitrobenzamide |
|---|---|
| PubChem CID | 61050993 |
| Molecular Formula | C14H16FN3O3 |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | N-(2-cyanoethyl)-5-fluoro-N-(2-methylpropyl)-2-nitrobenzamide |
| SMILES | CC(C)CN(CCC#N)C(=O)c1cc(F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H16FN3O3/c1-10(2)9-17(7-3-6-16)14(19)12-8-11(15)4-5-13(12)18(20)21/h4-5,8,10H,3,7,9H2,1-2H3 |
| InChIKey | KFJOIOZLLCDLQO-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 87.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|