About 2-[(2-chloro-1,3-thiazol-5-yl)sulfonyl-methylamino]-N-propylacetamide
2-[(2-chloro-1,3-thiazol-5-yl)sulfonyl-methylamino]-N-propylacetamide (PubChem CID 61051108) has the molecular formula C9H14ClN3O3S2
and a molecular weight of 311.82 g/mol. Its IUPAC name is 2-[(2-chloro-1,3-thiazol-5-yl)sulfonyl-methylamino]-N-propylacetamide.
Molecular Properties
| Compound Name | 2-[(2-chloro-1,3-thiazol-5-yl)sulfonyl-methylamino]-N-propylacetamide |
| PubChem CID | 61051108 |
| Molecular Formula | C9H14ClN3O3S2 |
| Molecular Weight | 311.82 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | 2-[(2-chloro-1,3-thiazol-5-yl)sulfonyl-methylamino]-N-propylacetamide |
| SMILES | CCCNC(=O)CN(C)S(=O)(=O)c1cnc(Cl)s1 |
| InChI | InChI=1S/C9H14ClN3O3S2/c1-3-4-11-7(14)6-13(2)18(15,16)8-5-12-9(10)17-8/h5H,3-4,6H2,1-2H3,(H,11,14) |
| InChIKey | GNWRUCRQJMPETR-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.82 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(2-chloro-1,3-thiazol-5-yl)sulfonyl-methylamino]-N-propylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-chloro-1,3-thiazol-5-yl)sulfonyl-methylamino]-N-propylacetamide?
The IUPAC name of 2-[(2-chloro-1,3-thiazol-5-yl)sulfonyl-methylamino]-N-propylacetamide (CID 61051108) is 2-[(2-chloro-1,3-thiazol-5-yl)sulfonyl-methylamino]-N-propylacetamide.
What is the SMILES notation for 2-[(2-chloro-1,3-thiazol-5-yl)sulfonyl-methylamino]-N-propylacetamide?
The canonical SMILES for 2-[(2-chloro-1,3-thiazol-5-yl)sulfonyl-methylamino]-N-propylacetamide is CCCNC(=O)CN(C)S(=O)(=O)c1cnc(Cl)s1.
What is the InChIKey of 2-[(2-chloro-1,3-thiazol-5-yl)sulfonyl-methylamino]-N-propylacetamide?
The InChIKey is GNWRUCRQJMPETR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14ClN3O3S2/c1-3-4-11-7(14)6-13(2)18(15,16)8-5-12-9(10)17-8/h5H,3-4,6H2,1-2H3,(H,11,14).
What are the key properties of 2-[(2-chloro-1,3-thiazol-5-yl)sulfonyl-methylamino]-N-propylacetamide?
2-[(2-chloro-1,3-thiazol-5-yl)sulfonyl-methylamino]-N-propylacetamide has a molecular weight of 311.82 g/mol, XLogP of 0.94, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-chloro-1,3-thiazol-5-yl)sulfonyl-methylamino]-N-propylacetamide is sourced from PubChem (CID 61051108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).