C10H7Cl2N3O4S2 — CID 61051495
2-chloro-N-(4-chloro-3-nitrophenyl)-4-methyl-1,3-thiazole-5-sulfonamide (PubChem CID 61051495) has the molecular formula C10H7Cl2N3O4S2 and a molecular weight of 368.22 g/mol. Its IUPAC name is 2-chloro-N-(4-chloro-3-nitrophenyl)-4-methyl-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-chloro-N-(4-chloro-3-nitrophenyl)-4-methyl-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 61051495 |
| Molecular Formula | C10H7Cl2N3O4S2 |
| Molecular Weight | 368.22 g/mol |
| Exact Mass | 366.93 |
| IUPAC Name | 2-chloro-N-(4-chloro-3-nitrophenyl)-4-methyl-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1nc(Cl)sc1S(=O)(=O)Nc1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H7Cl2N3O4S2/c1-5-9(20-10(12)13-5)21(18,19)14-6-2-3-7(11)8(4-6)15(16)17/h2-4,14H,1H3 |
| InChIKey | BREVJUNDHQAPFX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.22 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|