About methyl 2-[(2-chloroimidazo[1,2-a]pyridin-3-yl)sulfonylamino]-3-hydroxypropanoate
methyl 2-[(2-chloroimidazo[1,2-a]pyridin-3-yl)sulfonylamino]-3-hydroxypropanoate (PubChem CID 61052088) has the molecular formula C11H12ClN3O5S
and a molecular weight of 333.75 g/mol. Its IUPAC name is methyl 2-[(2-chloroimidazo[1,2-a]pyridin-3-yl)sulfonylamino]-3-hydroxypropanoate.
Molecular Properties
| Compound Name | methyl 2-[(2-chloroimidazo[1,2-a]pyridin-3-yl)sulfonylamino]-3-hydroxypropanoate |
| PubChem CID | 61052088 |
| Molecular Formula | C11H12ClN3O5S |
| Molecular Weight | 333.75 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | methyl 2-[(2-chloroimidazo[1,2-a]pyridin-3-yl)sulfonylamino]-3-hydroxypropanoate |
| SMILES | COC(=O)C(CO)NS(=O)(=O)c1c(Cl)nc2ccccn12 |
| InChI | InChI=1S/C11H12ClN3O5S/c1-20-11(17)7(6-16)14-21(18,19)10-9(12)13-8-4-2-3-5-15(8)10/h2-5,7,14,16H,6H2,1H3 |
| InChIKey | AOSURBNHZAYJAV-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.75 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 2-[(2-chloroimidazo[1,2-a]pyridin-3-yl)sulfonylamino]-3-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(2-chloroimidazo[1,2-a]pyridin-3-yl)sulfonylamino]-3-hydroxypropanoate?
The IUPAC name of methyl 2-[(2-chloroimidazo[1,2-a]pyridin-3-yl)sulfonylamino]-3-hydroxypropanoate (CID 61052088) is methyl 2-[(2-chloroimidazo[1,2-a]pyridin-3-yl)sulfonylamino]-3-hydroxypropanoate.
What is the SMILES notation for methyl 2-[(2-chloroimidazo[1,2-a]pyridin-3-yl)sulfonylamino]-3-hydroxypropanoate?
The canonical SMILES for methyl 2-[(2-chloroimidazo[1,2-a]pyridin-3-yl)sulfonylamino]-3-hydroxypropanoate is COC(=O)C(CO)NS(=O)(=O)c1c(Cl)nc2ccccn12.
What is the InChIKey of methyl 2-[(2-chloroimidazo[1,2-a]pyridin-3-yl)sulfonylamino]-3-hydroxypropanoate?
The InChIKey is AOSURBNHZAYJAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClN3O5S/c1-20-11(17)7(6-16)14-21(18,19)10-9(12)13-8-4-2-3-5-15(8)10/h2-5,7,14,16H,6H2,1H3.
What are the key properties of methyl 2-[(2-chloroimidazo[1,2-a]pyridin-3-yl)sulfonylamino]-3-hydroxypropanoate?
methyl 2-[(2-chloroimidazo[1,2-a]pyridin-3-yl)sulfonylamino]-3-hydroxypropanoate has a molecular weight of 333.75 g/mol, XLogP of -0.20, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(2-chloroimidazo[1,2-a]pyridin-3-yl)sulfonylamino]-3-hydroxypropanoate is sourced from PubChem (CID 61052088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).