About 2-[4-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]piperidin-1-yl]-N-methylacetamide
2-[4-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]piperidin-1-yl]-N-methylacetamide (PubChem CID 61052548) has the molecular formula C11H17ClN4O3S2
and a molecular weight of 352.87 g/mol. Its IUPAC name is 2-[4-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]piperidin-1-yl]-N-methylacetamide.
Molecular Properties
| Compound Name | 2-[4-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]piperidin-1-yl]-N-methylacetamide |
| PubChem CID | 61052548 |
| Molecular Formula | C11H17ClN4O3S2 |
| Molecular Weight | 352.87 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | 2-[4-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]piperidin-1-yl]-N-methylacetamide |
| SMILES | CNC(=O)CN1CCC(NS(=O)(=O)c2cnc(Cl)s2)CC1 |
| InChI | InChI=1S/C11H17ClN4O3S2/c1-13-9(17)7-16-4-2-8(3-5-16)15-21(18,19)10-6-14-11(12)20-10/h6,8,15H,2-5,7H2,1H3,(H,13,17) |
| InChIKey | BQCBMAVIEFHRQS-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.87 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[4-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]piperidin-1-yl]-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]piperidin-1-yl]-N-methylacetamide?
The IUPAC name of 2-[4-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]piperidin-1-yl]-N-methylacetamide (CID 61052548) is 2-[4-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]piperidin-1-yl]-N-methylacetamide.
What is the SMILES notation for 2-[4-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]piperidin-1-yl]-N-methylacetamide?
The canonical SMILES for 2-[4-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]piperidin-1-yl]-N-methylacetamide is CNC(=O)CN1CCC(NS(=O)(=O)c2cnc(Cl)s2)CC1.
What is the InChIKey of 2-[4-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]piperidin-1-yl]-N-methylacetamide?
The InChIKey is BQCBMAVIEFHRQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17ClN4O3S2/c1-13-9(17)7-16-4-2-8(3-5-16)15-21(18,19)10-6-14-11(12)20-10/h6,8,15H,2-5,7H2,1H3,(H,13,17).
What are the key properties of 2-[4-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]piperidin-1-yl]-N-methylacetamide?
2-[4-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]piperidin-1-yl]-N-methylacetamide has a molecular weight of 352.87 g/mol, XLogP of 0.29, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]piperidin-1-yl]-N-methylacetamide is sourced from PubChem (CID 61052548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).