C10H9Cl2F3N2O2 — CID 61053442
3,6-dichloro-N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide (PubChem CID 61053442) has the molecular formula C10H9Cl2F3N2O2 and a molecular weight of 317.09 g/mol. Its IUPAC name is 3,6-dichloro-N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide.
| Compound Name | 3,6-dichloro-N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 61053442 |
| Molecular Formula | C10H9Cl2F3N2O2 |
| Molecular Weight | 317.09 g/mol |
| Exact Mass | 316.00 |
| IUPAC Name | 3,6-dichloro-N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide |
| SMILES | O=C(c1nc(Cl)ccc1Cl)N(CCO)CC(F)(F)F |
| InChI | InChI=1S/C10H9Cl2F3N2O2/c11-6-1-2-7(12)16-8(6)9(19)17(3-4-18)5-10(13,14)15/h1-2,18H,3-5H2 |
| InChIKey | PLSFKLQWQNQDOH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.09 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|