C11H9FN4O3 — CID 61053649
2-fluoro-5-nitro-N-(1H-pyrazol-4-ylmethyl)benzamide (PubChem CID 61053649) has the molecular formula C11H9FN4O3 and a molecular weight of 264.22 g/mol. Its IUPAC name is 2-fluoro-5-nitro-N-(1H-pyrazol-4-ylmethyl)benzamide.
| Compound Name | 2-fluoro-5-nitro-N-(1H-pyrazol-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 61053649 |
| Molecular Formula | C11H9FN4O3 |
| Molecular Weight | 264.22 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 2-fluoro-5-nitro-N-(1H-pyrazol-4-ylmethyl)benzamide |
| SMILES | O=C(NCc1cn[nH]c1)c1cc([N+](=O)[O-])ccc1F |
| InChI | InChI=1S/C11H9FN4O3/c12-10-2-1-8(16(18)19)3-9(10)11(17)13-4-7-5-14-15-6-7/h1-3,5-6H,4H2,(H,13,17)(H,14,15) |
| InChIKey | YHKHQTHJROGDHN-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 100.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.22 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|