C13H13Cl2NOS — CID 61055196
2-(2,6-dichlorophenyl)-2-(thiophen-2-ylmethylamino)ethanol (PubChem CID 61055196) has the molecular formula C13H13Cl2NOS and a molecular weight of 302.23 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-2-(thiophen-2-ylmethylamino)ethanol.
| Compound Name | 2-(2,6-dichlorophenyl)-2-(thiophen-2-ylmethylamino)ethanol |
|---|---|
| PubChem CID | 61055196 |
| Molecular Formula | C13H13Cl2NOS |
| Molecular Weight | 302.23 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-2-(thiophen-2-ylmethylamino)ethanol |
| SMILES | OCC(NCc1cccs1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H13Cl2NOS/c14-10-4-1-5-11(15)13(10)12(8-17)16-7-9-3-2-6-18-9/h1-6,12,16-17H,7-8H2 |
| InChIKey | OFNVSSNCYYAAQM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.23 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |