C15H29NO — CID 61055766
[1-(cyclopentylamino)-3,3,5-trimethylcyclohexyl]methanol (PubChem CID 61055766) has the molecular formula C15H29NO and a molecular weight of 239.40 g/mol. Its IUPAC name is [1-(cyclopentylamino)-3,3,5-trimethylcyclohexyl]methanol.
| Compound Name | [1-(cyclopentylamino)-3,3,5-trimethylcyclohexyl]methanol |
|---|---|
| PubChem CID | 61055766 |
| Molecular Formula | C15H29NO |
| Molecular Weight | 239.40 g/mol |
| Exact Mass | 239.22 |
| IUPAC Name | [1-(cyclopentylamino)-3,3,5-trimethylcyclohexyl]methanol |
| SMILES | CC1CC(C)(C)CC(CO)(NC2CCCC2)C1 |
| InChI | InChI=1S/C15H29NO/c1-12-8-14(2,3)10-15(9-12,11-17)16-13-6-4-5-7-13/h12-13,16-17H,4-11H2,1-3H3 |
| InChIKey | MLXFLRGLUKHIDE-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |