C16H22FNO3 — CID 61057480
2-(azepan-1-yl)-2-(3-fluoro-4-methoxyphenyl)propanoic acid (PubChem CID 61057480) has the molecular formula C16H22FNO3 and a molecular weight of 295.35 g/mol. Its IUPAC name is 2-(azepan-1-yl)-2-(3-fluoro-4-methoxyphenyl)propanoic acid.
| Compound Name | 2-(azepan-1-yl)-2-(3-fluoro-4-methoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 61057480 |
| Molecular Formula | C16H22FNO3 |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 2-(azepan-1-yl)-2-(3-fluoro-4-methoxyphenyl)propanoic acid |
| SMILES | COc1ccc(C(C)(C(=O)O)N2CCCCCC2)cc1F |
| InChI | InChI=1S/C16H22FNO3/c1-16(15(19)20,18-9-5-3-4-6-10-18)12-7-8-14(21-2)13(17)11-12/h7-8,11H,3-6,9-10H2,1-2H3,(H,19,20) |
| InChIKey | DXHFBGRPWKVQJQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |