C9H17NO4S — CID 61057547
3-[(1,1-dioxothiolan-3-yl)methylamino]butanoic acid (PubChem CID 61057547) has the molecular formula C9H17NO4S and a molecular weight of 235.30 g/mol. Its IUPAC name is 3-[(1,1-dioxothiolan-3-yl)methylamino]butanoic acid.
| Compound Name | 3-[(1,1-dioxothiolan-3-yl)methylamino]butanoic acid |
|---|---|
| PubChem CID | 61057547 |
| Molecular Formula | C9H17NO4S |
| Molecular Weight | 235.30 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | 3-[(1,1-dioxothiolan-3-yl)methylamino]butanoic acid |
| SMILES | CC(CC(=O)O)NCC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H17NO4S/c1-7(4-9(11)12)10-5-8-2-3-15(13,14)6-8/h7-8,10H,2-6H2,1H3,(H,11,12) |
| InChIKey | NKFWOPDSRUTYQB-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.30 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |