About 2-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]prop-2-en-1-amine
2-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]prop-2-en-1-amine (PubChem CID 61058023) has the molecular formula C8H14ClNO2S
and a molecular weight of 223.72 g/mol. Its IUPAC name is 2-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]prop-2-en-1-amine.
Molecular Properties
| Compound Name | 2-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]prop-2-en-1-amine |
| PubChem CID | 61058023 |
| Molecular Formula | C8H14ClNO2S |
| Molecular Weight | 223.72 g/mol |
| Exact Mass | 223.04 |
| IUPAC Name | 2-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]prop-2-en-1-amine |
| SMILES | C=C(Cl)CNCC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H14ClNO2S/c1-7(9)4-10-5-8-2-3-13(11,12)6-8/h8,10H,1-6H2 |
| InChIKey | AOJHIHNTPCIGLW-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.72 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]prop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]prop-2-en-1-amine?
The IUPAC name of 2-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]prop-2-en-1-amine (CID 61058023) is 2-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]prop-2-en-1-amine.
What is the SMILES notation for 2-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]prop-2-en-1-amine?
The canonical SMILES for 2-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]prop-2-en-1-amine is C=C(Cl)CNCC1CCS(=O)(=O)C1.
What is the InChIKey of 2-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]prop-2-en-1-amine?
The InChIKey is AOJHIHNTPCIGLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14ClNO2S/c1-7(9)4-10-5-8-2-3-13(11,12)6-8/h8,10H,1-6H2.
What are the key properties of 2-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]prop-2-en-1-amine?
2-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]prop-2-en-1-amine has a molecular weight of 223.72 g/mol, XLogP of 0.76, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]prop-2-en-1-amine is sourced from PubChem (CID 61058023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).