C9H19NO2S — CID 61058303
1-(1,1-dioxothiolan-3-yl)-3-methylbutan-2-amine (PubChem CID 61058303) has the molecular formula C9H19NO2S and a molecular weight of 205.32 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-methylbutan-2-amine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-methylbutan-2-amine |
|---|---|
| PubChem CID | 61058303 |
| Molecular Formula | C9H19NO2S |
| Molecular Weight | 205.32 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-methylbutan-2-amine |
| SMILES | CC(C)C(N)CC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H19NO2S/c1-7(2)9(10)5-8-3-4-13(11,12)6-8/h7-9H,3-6,10H2,1-2H3 |
| InChIKey | NGWDKKSEEYCMMN-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.32 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |