C16H23NO3S — CID 61058395
3-[(1,1-dioxothiolan-3-yl)methylamino]-1,7-dimethyl-2,3-dihydro-1H-inden-4-ol (PubChem CID 61058395) has the molecular formula C16H23NO3S and a molecular weight of 309.43 g/mol. Its IUPAC name is 3-[(1,1-dioxothiolan-3-yl)methylamino]-1,7-dimethyl-2,3-dihydro-1H-inden-4-ol.
| Compound Name | 3-[(1,1-dioxothiolan-3-yl)methylamino]-1,7-dimethyl-2,3-dihydro-1H-inden-4-ol |
|---|---|
| PubChem CID | 61058395 |
| Molecular Formula | C16H23NO3S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 3-[(1,1-dioxothiolan-3-yl)methylamino]-1,7-dimethyl-2,3-dihydro-1H-inden-4-ol |
| SMILES | Cc1ccc(O)c2c1C(C)CC2NCC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H23NO3S/c1-10-3-4-14(18)16-13(7-11(2)15(10)16)17-8-12-5-6-21(19,20)9-12/h3-4,11-13,17-18H,5-9H2,1-2H3 |
| InChIKey | OPAWOUABKJIQJA-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|