C13H18BrNO3S — CID 61059880
5-bromo-2-methoxy-N-propan-2-yl-N-prop-2-enylbenzenesulfonamide (PubChem CID 61059880) has the molecular formula C13H18BrNO3S and a molecular weight of 348.26 g/mol. Its IUPAC name is 5-bromo-2-methoxy-N-propan-2-yl-N-prop-2-enylbenzenesulfonamide.
| Compound Name | 5-bromo-2-methoxy-N-propan-2-yl-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 61059880 |
| Molecular Formula | C13H18BrNO3S |
| Molecular Weight | 348.26 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | 5-bromo-2-methoxy-N-propan-2-yl-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCN(C(C)C)S(=O)(=O)c1cc(Br)ccc1OC |
| InChI | InChI=1S/C13H18BrNO3S/c1-5-8-15(10(2)3)19(16,17)13-9-11(14)6-7-12(13)18-4/h5-7,9-10H,1,8H2,2-4H3 |
| InChIKey | FKZGWQUTSRWXLX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.26 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|