C11H13BrClN3O3S — CID 61060873
5-bromo-2-chloro-N-(2-oxoazepan-3-yl)pyridine-3-sulfonamide (PubChem CID 61060873) has the molecular formula C11H13BrClN3O3S and a molecular weight of 382.67 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-(2-oxoazepan-3-yl)pyridine-3-sulfonamide.
| Compound Name | 5-bromo-2-chloro-N-(2-oxoazepan-3-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 61060873 |
| Molecular Formula | C11H13BrClN3O3S |
| Molecular Weight | 382.67 g/mol |
| Exact Mass | 380.95 |
| IUPAC Name | 5-bromo-2-chloro-N-(2-oxoazepan-3-yl)pyridine-3-sulfonamide |
| SMILES | O=C1NCCCCC1NS(=O)(=O)c1cc(Br)cnc1Cl |
| InChI | InChI=1S/C11H13BrClN3O3S/c12-7-5-9(10(13)15-6-7)20(18,19)16-8-3-1-2-4-14-11(8)17/h5-6,8,16H,1-4H2,(H,14,17) |
| InChIKey | DRELVNYKOJEBHX-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.67 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|