C12H7BrF3NO2S — CID 61061949
5-bromo-N-[4-(difluoromethoxy)-3-fluorophenyl]thiophene-2-carboxamide (PubChem CID 61061949) has the molecular formula C12H7BrF3NO2S and a molecular weight of 366.16 g/mol. Its IUPAC name is 5-bromo-N-[4-(difluoromethoxy)-3-fluorophenyl]thiophene-2-carboxamide.
| Compound Name | 5-bromo-N-[4-(difluoromethoxy)-3-fluorophenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 61061949 |
| Molecular Formula | C12H7BrF3NO2S |
| Molecular Weight | 366.16 g/mol |
| Exact Mass | 364.93 |
| IUPAC Name | 5-bromo-N-[4-(difluoromethoxy)-3-fluorophenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)F)c(F)c1)c1ccc(Br)s1 |
| InChI | InChI=1S/C12H7BrF3NO2S/c13-10-4-3-9(20-10)11(18)17-6-1-2-8(7(14)5-6)19-12(15)16/h1-5,12H,(H,17,18) |
| InChIKey | DIXIFUWZJYGYMU-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.16 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |