C12H15ClF3NO2S — CID 61062150
4-(2-chloroethyl)-N-ethyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide (PubChem CID 61062150) has the molecular formula C12H15ClF3NO2S and a molecular weight of 329.77 g/mol. Its IUPAC name is 4-(2-chloroethyl)-N-ethyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide.
| Compound Name | 4-(2-chloroethyl)-N-ethyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 61062150 |
| Molecular Formula | C12H15ClF3NO2S |
| Molecular Weight | 329.77 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | 4-(2-chloroethyl)-N-ethyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
| SMILES | CCN(CC(F)(F)F)S(=O)(=O)c1ccc(CCCl)cc1 |
| InChI | InChI=1S/C12H15ClF3NO2S/c1-2-17(9-12(14,15)16)20(18,19)11-5-3-10(4-6-11)7-8-13/h3-6H,2,7-9H2,1H3 |
| InChIKey | AXXDONCXSCAGEV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.77 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|