C19H14BrF5N2O4 — CID 6106265
[4-[(Z)-[acetyl-(2,3,4,5,6-pentafluorophenyl)hydrazinylidene]methyl]-5-bromo-2-ethoxyphenyl] acetate (PubChem CID 6106265) has the molecular formula C19H14BrF5N2O4 and a molecular weight of 509.23 g/mol. Its IUPAC name is [4-[(Z)-[acetyl-(2,3,4,5,6-pentafluorophenyl)hydrazinylidene]methyl]-5-bromo-2-ethoxyphenyl] acetate.
| Compound Name | [4-[(Z)-[acetyl-(2,3,4,5,6-pentafluorophenyl)hydrazinylidene]methyl]-5-bromo-2-ethoxyphenyl] acetate |
|---|---|
| PubChem CID | 6106265 |
| Molecular Formula | C19H14BrF5N2O4 |
| Molecular Weight | 509.23 g/mol |
| Exact Mass | 508.01 |
| IUPAC Name | [4-[(Z)-[acetyl-(2,3,4,5,6-pentafluorophenyl)hydrazinylidene]methyl]-5-bromo-2-ethoxyphenyl] acetate |
| SMILES | CCOc1cc(/C=N\N(C(C)=O)c2c(F)c(F)c(F)c(F)c2F)c(Br)cc1OC(C)=O |
| InChI | InChI=1S/C19H14BrF5N2O4/c1-4-30-12-5-10(11(20)6-13(12)31-9(3)29)7-26-27(8(2)28)19-17(24)15(22)14(21)16(23)18(19)25/h5-7H,4H2,1-3H3/b26-7- |
| InChIKey | NEIMZPSIHBRHHY-FFFWXYFFSA-N |
| XLogP | 4.86 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.23 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|