C15H20N2OS — CID 61062685
2-(1-benzothiophen-5-ylamino)-N-(3-methylbutyl)acetamide (PubChem CID 61062685) has the molecular formula C15H20N2OS and a molecular weight of 276.40 g/mol. Its IUPAC name is 2-(1-benzothiophen-5-ylamino)-N-(3-methylbutyl)acetamide.
| Compound Name | 2-(1-benzothiophen-5-ylamino)-N-(3-methylbutyl)acetamide |
|---|---|
| PubChem CID | 61062685 |
| Molecular Formula | C15H20N2OS |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 2-(1-benzothiophen-5-ylamino)-N-(3-methylbutyl)acetamide |
| SMILES | CC(C)CCNC(=O)CNc1ccc2sccc2c1 |
| InChI | InChI=1S/C15H20N2OS/c1-11(2)5-7-16-15(18)10-17-13-3-4-14-12(9-13)6-8-19-14/h3-4,6,8-9,11,17H,5,7,10H2,1-2H3,(H,16,18) |
| InChIKey | FEOIXKPOWADEFQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |