C11H7Br2NO4S2 — CID 61062715
4-[(2,4-dibromophenyl)sulfamoyl]thiophene-2-carboxylic acid (PubChem CID 61062715) has the molecular formula C11H7Br2NO4S2 and a molecular weight of 441.12 g/mol. Its IUPAC name is 4-[(2,4-dibromophenyl)sulfamoyl]thiophene-2-carboxylic acid.
| Compound Name | 4-[(2,4-dibromophenyl)sulfamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 61062715 |
| Molecular Formula | C11H7Br2NO4S2 |
| Molecular Weight | 441.12 g/mol |
| Exact Mass | 438.82 |
| IUPAC Name | 4-[(2,4-dibromophenyl)sulfamoyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)Nc2ccc(Br)cc2Br)cs1 |
| InChI | InChI=1S/C11H7Br2NO4S2/c12-6-1-2-9(8(13)3-6)14-20(17,18)7-4-10(11(15)16)19-5-7/h1-5,14H,(H,15,16) |
| InChIKey | XNHMMTQYMIMINY-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.12 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |